CAS 190850-76-1 is the registry number for (2S,3S)-1,4-Dichlorobutane-diol Sulfate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(4S,5S)-4,5-bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide (CAS 190850-76-1) is a chemical compound with the molecular formula C4H6Cl2O4S and a molecular weight of 221.06 g/mol. IUPAC name: (4S,5S)-4,5-bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide. InChIKey: RIWLWZZVVQCXJG-QWWZWVQMSA-N.
| Molecular formula | C4H6Cl2O4S |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | (4S,5S)-4,5-bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide |
| InChIKey | RIWLWZZVVQCXJG-QWWZWVQMSA-N |
| SMILES | C([C@@H]1[C@H](OS(=O)(=O)O1)CCl)Cl |
Computed by PubChem (NCBI)