Products 1909294-68-3
CAS 1909294-68-3 is the registry number for rac-((2R,3S)-1-Cyclopropyl-2-(1-methyl-1H-pyrazol-5-yl)piperidin-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
[(2S,3R)-1-cyclopropyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methanamine (CAS 1909294-68-3) is a chemical compound with the molecular formula C13H22N4 and a molecular weight of 234.34 g/mol. IUPAC name: [(2S,3R)-1-cyclopropyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methanamine. InChIKey: CLQJJIMBCJTEAB-MFKMUULPSA-N.
| Molecular formula | C13H22N4 |
|---|---|
| Molecular weight | 234.34 g/mol |
| IUPAC name | [(2S,3R)-1-cyclopropyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methanamine |
| InChIKey | CLQJJIMBCJTEAB-MFKMUULPSA-N |
| SMILES | CN1C(=CC=N1)[C@@H]2[C@H](CCCN2C3CC3)CN |
Computed by PubChem (NCBI)