CAS 1909296-14-5 is the registry number for 2-Chloro-2,2-difluoro-1-(2-methyl-1H-indol-3-yl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-chloro-2,2-difluoro-1-(2-methyl-1H-indol-3-yl)ethanone (CAS 1909296-14-5) is a chemical compound with the molecular formula C11H8ClF2NO and a molecular weight of 243.63 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-(2-methyl-1H-indol-3-yl)ethanone. InChIKey: LKDYGXBTAQJJNP-UHFFFAOYSA-N.
| Molecular formula | C11H8ClF2NO |
|---|---|
| Molecular weight | 243.63 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-(2-methyl-1H-indol-3-yl)ethanone |
| InChIKey | LKDYGXBTAQJJNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)