CAS 1909305-10-7 is the registry number for 1-Methyl-1H-indole-2-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-methylindole-2-sulfonyl fluoride (CAS 1909305-10-7) is a chemical compound with the molecular formula C9H8FNO2S and a molecular weight of 213.23 g/mol. IUPAC name: 1-methylindole-2-sulfonyl fluoride. InChIKey: RFDLWOGUNMOJHX-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2S |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 1-methylindole-2-sulfonyl fluoride |
| InChIKey | RFDLWOGUNMOJHX-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C=C1S(=O)(=O)F |
Computed by PubChem (NCBI)