CAS 1909308-86-6 appears in our catalog under these names: 1-(Azetidin-3-yl)-1,3-diazinan-2-one dihydrochloride, 95%, 1-(Azetidin-3-yl)-1,3-diazinan-2-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(azetidin-3-yl)-1,3-diazinan-2-one;dihydrochloride (CAS 1909308-86-6) is a chemical compound with the molecular formula C7H15Cl2N3O and a molecular weight of 228.12 g/mol. IUPAC name: 1-(azetidin-3-yl)-1,3-diazinan-2-one;dihydrochloride. InChIKey: BEOUAHCODWHRDT-UHFFFAOYSA-N.
| Molecular formula | C7H15Cl2N3O |
|---|---|
| Molecular weight | 228.12 g/mol |
| IUPAC name | 1-(azetidin-3-yl)-1,3-diazinan-2-one;dihydrochloride |
| InChIKey | BEOUAHCODWHRDT-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2CNC2.Cl.Cl |
Computed by PubChem (NCBI)