CAS 1909308-99-1 is the registry number for Potassium (7,7-dimethyl-5-oxo-5,6,7,8-tetrahydroquinazolin-2-yl)sulfanide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Potassium 7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-2-thiolate (CAS 1909308-99-1) is a chemical compound with the molecular formula C10H11KN2OS and a molecular weight of 246.37 g/mol. IUPAC name: potassium 7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-2-thiolate. InChIKey: KXNYXSDHSWADHN-UHFFFAOYSA-M.
| Molecular formula | C10H11KN2OS |
|---|---|
| Molecular weight | 246.37 g/mol |
| IUPAC name | potassium 7,7-dimethyl-5-oxo-6,8-dihydroquinazoline-2-thiolate |
| InChIKey | KXNYXSDHSWADHN-UHFFFAOYSA-M |
| SMILES | CC1(CC2=NC(=NC=C2C(=O)C1)[S-])C.[K+] |
Computed by PubChem (NCBI)