Products 1909309-00-7
CAS 1909309-00-7 is the registry number for 3-bromopyridine-4-carbonyl chloride hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-bromopyridine-4-carbonyl chloride;hydrochloride (CAS 1909309-00-7) is a chemical compound with the molecular formula C6H4BrCl2NO and a molecular weight of 256.91 g/mol. IUPAC name: 3-bromopyridine-4-carbonyl chloride;hydrochloride. InChIKey: HNYXESUWOIJMQO-UHFFFAOYSA-N.
| Molecular formula | C6H4BrCl2NO |
|---|---|
| Molecular weight | 256.91 g/mol |
| IUPAC name | 3-bromopyridine-4-carbonyl chloride;hydrochloride |
| InChIKey | HNYXESUWOIJMQO-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)Cl)Br.Cl |
Computed by PubChem (NCBI)