Products 1909309-21-2

CAS 1909309-21-2 is the registry number for tert-Butyl N-(4-(4-fluorophenyl)-1,3-thiazol-5-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[4-(4-fluorophenyl)-1,3-thiazol-5-yl]carbamate (CAS 1909309-21-2) is a chemical compound with the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. IUPAC name: tert-butyl N-[4-(4-fluorophenyl)-1,3-thiazol-5-yl]carbamate. InChIKey: XIMQQGVCYBACMI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15FN2O2S
Molecular weight294.35 g/mol
IUPAC nametert-butyl N-[4-(4-fluorophenyl)-1,3-thiazol-5-yl]carbamate
InChIKeyXIMQQGVCYBACMI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(N=CS1)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)