CAS 1909309-21-2 is the registry number for tert-Butyl N-(4-(4-fluorophenyl)-1,3-thiazol-5-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[4-(4-fluorophenyl)-1,3-thiazol-5-yl]carbamate (CAS 1909309-21-2) is a chemical compound with the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. IUPAC name: tert-butyl N-[4-(4-fluorophenyl)-1,3-thiazol-5-yl]carbamate. InChIKey: XIMQQGVCYBACMI-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2O2S |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | tert-butyl N-[4-(4-fluorophenyl)-1,3-thiazol-5-yl]carbamate |
| InChIKey | XIMQQGVCYBACMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N=CS1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)