CAS 1909309-39-2 appears in our catalog under these names: tert-Butyl 2-amino-2-(1-methyl-1H-pyrazol-5-yl)acetate hydrochloride, tert-Butyl 2-amino-2-(1-methyl-1H-pyrazol-5-yl)acetate hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
Tert-butyl 2-amino-2-(2-methylpyrazol-3-yl)acetate;hydrochloride (CAS 1909309-39-2) is a chemical compound with the molecular formula C10H18ClN3O2 and a molecular weight of 247.72 g/mol. IUPAC name: tert-butyl 2-amino-2-(2-methylpyrazol-3-yl)acetate;hydrochloride. InChIKey: WNURYHIAARHNDX-UHFFFAOYSA-N.
| Molecular formula | C10H18ClN3O2 |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | tert-butyl 2-amino-2-(2-methylpyrazol-3-yl)acetate;hydrochloride |
| InChIKey | WNURYHIAARHNDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C1=CC=NN1C)N.Cl |
Computed by PubChem (NCBI)