CAS 1909309-40-5 is the registry number for tert-Butyl N-(2-(4-bromo-2-fluorophenoxy)ethyl)-N-methylcarbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-[2-(4-bromo-2-fluorophenoxy)ethyl]-N-methylcarbamate (CAS 1909309-40-5) is a chemical compound with the molecular formula C14H19BrFNO3 and a molecular weight of 348.21 g/mol. IUPAC name: tert-butyl N-[2-(4-bromo-2-fluorophenoxy)ethyl]-N-methylcarbamate. InChIKey: QCVZBAAECJINDB-UHFFFAOYSA-N.
| Molecular formula | C14H19BrFNO3 |
|---|---|
| Molecular weight | 348.21 g/mol |
| IUPAC name | tert-butyl N-[2-(4-bromo-2-fluorophenoxy)ethyl]-N-methylcarbamate |
| InChIKey | QCVZBAAECJINDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCOC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)