CAS 1909309-77-8 appears in our catalog under these names: 1-(Benzylsulfanyl)-2-fluoro-4-(trifluoromethyl)benzene, 95%, 1-(Benzylsulfanyl)-2-fluoro-4-(trifluoromethyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-benzylsulfanyl-2-fluoro-4-(trifluoromethyl)benzene (CAS 1909309-77-8) is a chemical compound with the molecular formula C14H10F4S and a molecular weight of 286.29 g/mol. IUPAC name: 1-benzylsulfanyl-2-fluoro-4-(trifluoromethyl)benzene. InChIKey: XECFHLBLUOUSIH-UHFFFAOYSA-N.
| Molecular formula | C14H10F4S |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | 1-benzylsulfanyl-2-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | XECFHLBLUOUSIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=C(C=C(C=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)