CAS 1909312-06-6 is the registry number for Lithium 2-(1-methyl-1H-1,3-benzodiazol-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 2-(1-methylbenzimidazol-2-yl)acetate (CAS 1909312-06-6) is a chemical compound with the molecular formula C10H9LiN2O2 and a molecular weight of 196.2 g/mol. IUPAC name: lithium 2-(1-methylbenzimidazol-2-yl)acetate. InChIKey: OCIXIJXOTFMKAR-UHFFFAOYSA-M.
| Molecular formula | C10H9LiN2O2 |
|---|---|
| Molecular weight | 196.2 g/mol |
| IUPAC name | lithium 2-(1-methylbenzimidazol-2-yl)acetate |
| InChIKey | OCIXIJXOTFMKAR-UHFFFAOYSA-M |
| SMILES | [Li+].CN1C2=CC=CC=C2N=C1CC(=O)[O-] |
Computed by PubChem (NCBI)