CAS 1909312-75-9 appears in our catalog under these names: 4-(5-Chloro-1-methyl-1H-imidazol-2-yl)-1,3-thiazol-2-amine hydrochloride, 95%, 4-(5-Chloro-1-methyl-1H-imidazol-2-yl)-1,3-thiazol-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(5-chloro-1-methylimidazol-2-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 1909312-75-9) is a chemical compound with the molecular formula C7H8Cl2N4S and a molecular weight of 251.14 g/mol. IUPAC name: 4-(5-chloro-1-methylimidazol-2-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: DOVHVWGJEUSFHP-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N4S |
|---|---|
| Molecular weight | 251.14 g/mol |
| IUPAC name | 4-(5-chloro-1-methylimidazol-2-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | DOVHVWGJEUSFHP-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1C2=CSC(=N2)N)Cl.Cl |
Computed by PubChem (NCBI)