CAS 1909313-69-4 is the registry number for 4-(3-Fluorophenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-fluorophenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole;hydrobromide (CAS 1909313-69-4) is a chemical compound with the molecular formula C13H10BrFN2S and a molecular weight of 325.20 g/mol. IUPAC name: 4-(3-fluorophenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole;hydrobromide. InChIKey: OEVQIMNNFOANKB-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFN2S |
|---|---|
| Molecular weight | 325.20 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole;hydrobromide |
| InChIKey | OEVQIMNNFOANKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CSC(=N2)C3=CC=CN3.Br |
Computed by PubChem (NCBI)