Products 1909316-05-7

CAS 1909316-05-7 is the registry number for tert-Butyl 5-methylpiperidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 5-methylpiperidine-3-carboxylate (CAS 1909316-05-7) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl 5-methylpiperidine-3-carboxylate. InChIKey: MPKJLVGZCOSWED-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO2
Molecular weight199.29 g/mol
IUPAC nametert-butyl 5-methylpiperidine-3-carboxylate
InChIKeyMPKJLVGZCOSWED-UHFFFAOYSA-N
SMILESCC1CC(CNC1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)