Products 1909316-27-3

CAS 1909316-27-3 appears in our catalog under these names: 2-(Chloromethyl)prop-2-ene-1-sulfonyl chloride, 95%, 2-(Chloromethyl)prop-2-ene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-(chloromethyl)prop-2-ene-1-sulfonyl chloride (CAS 1909316-27-3) is a chemical compound with the molecular formula C4H6Cl2O2S and a molecular weight of 189.06 g/mol. IUPAC name: 2-(chloromethyl)prop-2-ene-1-sulfonyl chloride. InChIKey: XEUQJNBKZBZLCW-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6Cl2O2S
Molecular weight189.06 g/mol
IUPAC name2-(chloromethyl)prop-2-ene-1-sulfonyl chloride
InChIKeyXEUQJNBKZBZLCW-UHFFFAOYSA-N
SMILESC=C(CS(=O)(=O)Cl)CCl

Computed by PubChem (NCBI)