CAS 1909316-37-5 is the registry number for 1-(3,4,5-Trichlorophenyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,4,5-trichlorophenyl)piperazine;hydrochloride (CAS 1909316-37-5) is a chemical compound with the molecular formula C10H12Cl4N2 and a molecular weight of 302.0 g/mol. IUPAC name: 1-(3,4,5-trichlorophenyl)piperazine;hydrochloride. InChIKey: FJSKYJJZTOOYRY-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl4N2 |
|---|---|
| Molecular weight | 302.0 g/mol |
| IUPAC name | 1-(3,4,5-trichlorophenyl)piperazine;hydrochloride |
| InChIKey | FJSKYJJZTOOYRY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=C(C(=C2)Cl)Cl)Cl.Cl |
Computed by PubChem (NCBI)