CAS 1909316-87-5 appears in our catalog under these names: Sodium 2-(5-methyl-1,3,4-thiadiazol-2-yl)acetate, 98%, Sodium 2-(5-methyl-1,3,4-thiadiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-(5-methyl-1,3,4-thiadiazol-2-yl)acetate (CAS 1909316-87-5) is a chemical compound with the molecular formula C5H5N2NaO2S and a molecular weight of 180.16 g/mol. IUPAC name: sodium 2-(5-methyl-1,3,4-thiadiazol-2-yl)acetate. InChIKey: DJSCLIKKFYMZIL-UHFFFAOYSA-M.
| Molecular formula | C5H5N2NaO2S |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | sodium 2-(5-methyl-1,3,4-thiadiazol-2-yl)acetate |
| InChIKey | DJSCLIKKFYMZIL-UHFFFAOYSA-M |
| SMILES | CC1=NN=C(S1)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)