Products 1909316-93-3
CAS 1909316-93-3 appears in our catalog under these names: 5-(Benzofuran-2-yl)-3-(piperidin-3-yl)-1,2,4-oxadiazole hydrochloride, 95%, 3-(5-(1-Benzofuran-2-yl)-1,2,4-oxadiazol-3-yl)piperidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(1-benzofuran-2-yl)-3-piperidin-3-yl-1,2,4-oxadiazole;hydrochloride (CAS 1909316-93-3) is a chemical compound with the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. IUPAC name: 5-(1-benzofuran-2-yl)-3-piperidin-3-yl-1,2,4-oxadiazole;hydrochloride. InChIKey: JMPXGHVZNQTVLE-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3O2 |
|---|---|
| Molecular weight | 305.76 g/mol |
| IUPAC name | 5-(1-benzofuran-2-yl)-3-piperidin-3-yl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | JMPXGHVZNQTVLE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NOC(=N2)C3=CC4=CC=CC=C4O3.Cl |
Computed by PubChem (NCBI)