CAS 1909317-05-0 is the registry number for Ethyl 1-(4-chloro-2-fluorophenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 1-(4-chloro-2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate (CAS 1909317-05-0) is a chemical compound with the molecular formula C15H14ClFN2O2 and a molecular weight of 308.73 g/mol. IUPAC name: ethyl 1-(4-chloro-2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate. InChIKey: IBCWMJSKCUPBIK-UHFFFAOYSA-N.
| Molecular formula | C15H14ClFN2O2 |
|---|---|
| Molecular weight | 308.73 g/mol |
| IUPAC name | ethyl 1-(4-chloro-2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
| InChIKey | IBCWMJSKCUPBIK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C2=C1CCC2)C3=C(C=C(C=C3)Cl)F |
Computed by PubChem (NCBI)