CAS 1909317-20-9 appears in our catalog under these names: 4,5-Bis((methylamino)methyl)thiophene-2-carboxylic acid dihydrochloride, 95%, 4,5-Bis((methylamino)methyl)thiophene-2-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5-bis(methylaminomethyl)thiophene-2-carboxylic acid;dihydrochloride (CAS 1909317-20-9) is a chemical compound with the molecular formula C9H16Cl2N2O2S and a molecular weight of 287.21 g/mol. IUPAC name: 4,5-bis(methylaminomethyl)thiophene-2-carboxylic acid;dihydrochloride. InChIKey: QHKGNTXFZCMSHZ-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2O2S |
|---|---|
| Molecular weight | 287.21 g/mol |
| IUPAC name | 4,5-bis(methylaminomethyl)thiophene-2-carboxylic acid;dihydrochloride |
| InChIKey | QHKGNTXFZCMSHZ-UHFFFAOYSA-N |
| SMILES | CNCC1=C(SC(=C1)C(=O)O)CNC.Cl.Cl |
Computed by PubChem (NCBI)