CAS 1909317-33-4 is the registry number for Methyl 4-bromo-3-hydrazinylbenzoate dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-bromo-3-hydrazinylbenzoate;dihydrochloride (CAS 1909317-33-4) is a chemical compound with the molecular formula C8H11BrCl2N2O2 and a molecular weight of 317.99 g/mol. IUPAC name: methyl 4-bromo-3-hydrazinylbenzoate;dihydrochloride. InChIKey: JQRHKNUZMISKRY-UHFFFAOYSA-N.
| Molecular formula | C8H11BrCl2N2O2 |
|---|---|
| Molecular weight | 317.99 g/mol |
| IUPAC name | methyl 4-bromo-3-hydrazinylbenzoate;dihydrochloride |
| InChIKey | JQRHKNUZMISKRY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)NN.Cl.Cl |
Computed by PubChem (NCBI)