CAS 1909317-40-3 appears in our catalog under these names: 4-(4-Fluorophenyl)-1,3-thiazol-5-amine hydrochloride, 95%, 4-(4-Fluorophenyl)-1,3-thiazol-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(4-fluorophenyl)-1,3-thiazol-5-amine;hydrochloride (CAS 1909317-40-3) is a chemical compound with the molecular formula C9H8ClFN2S and a molecular weight of 230.69 g/mol. IUPAC name: 4-(4-fluorophenyl)-1,3-thiazol-5-amine;hydrochloride. InChIKey: IGABLCWSKILGOU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFN2S |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-1,3-thiazol-5-amine;hydrochloride |
| InChIKey | IGABLCWSKILGOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SC=N2)N)F.Cl |
Computed by PubChem (NCBI)