CAS 1909319-21-6 is the registry number for 2-Amino-5-bromo-2,3-dihydro-1H-isoindole-1,3-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-5-bromoisoindole-1,3-dione;hydrochloride (CAS 1909319-21-6) is a chemical compound with the molecular formula C8H6BrClN2O2 and a molecular weight of 277.50 g/mol. IUPAC name: 2-amino-5-bromoisoindole-1,3-dione;hydrochloride. InChIKey: PSKGJLDNSFJHTH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2O2 |
|---|---|
| Molecular weight | 277.50 g/mol |
| IUPAC name | 2-amino-5-bromoisoindole-1,3-dione;hydrochloride |
| InChIKey | PSKGJLDNSFJHTH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)N(C2=O)N.Cl |
Computed by PubChem (NCBI)