CAS 1909319-29-4 appears in our catalog under these names: 2-(3-Amino-1H-1,2,4-triazol-1-yl)acetic acid dihydrochloride, 95%, 2-(3-Amino-1H-1,2,4-triazol-1-yl)acetic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3-amino-1,2,4-triazol-1-yl)acetic acid;dihydrochloride (CAS 1909319-29-4) is a chemical compound with the molecular formula C4H8Cl2N4O2 and a molecular weight of 215.04 g/mol. IUPAC name: 2-(3-amino-1,2,4-triazol-1-yl)acetic acid;dihydrochloride. InChIKey: RAXKJBUAQKHPHR-UHFFFAOYSA-N.
| Molecular formula | C4H8Cl2N4O2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 2-(3-amino-1,2,4-triazol-1-yl)acetic acid;dihydrochloride |
| InChIKey | RAXKJBUAQKHPHR-UHFFFAOYSA-N |
| SMILES | C1=NC(=NN1CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)