CAS 1909319-96-5 appears in our catalog under these names: 1-Amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol dihydrochloride, 95%, 1-Amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol;dihydrochloride (CAS 1909319-96-5) is a chemical compound with the molecular formula C7H14Cl2N2OS and a molecular weight of 245.17 g/mol. IUPAC name: 1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol;dihydrochloride. InChIKey: VYBKVAYCRIHHNZ-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N2OS |
|---|---|
| Molecular weight | 245.17 g/mol |
| IUPAC name | 1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol;dihydrochloride |
| InChIKey | VYBKVAYCRIHHNZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C(C(C)O)N.Cl.Cl |
Computed by PubChem (NCBI)