CAS 1909320-07-5 appears in our catalog under these names: Sodium 2-(3,4,5-trihydroxybenzoyloxy)acetate, 95%, Sodium 2-(3,4,5-trihydroxybenzoyloxy)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-(3,4,5-trihydroxybenzoyl)oxyacetate (CAS 1909320-07-5) is a chemical compound with the molecular formula C9H7NaO7 and a molecular weight of 250.14 g/mol. IUPAC name: sodium 2-(3,4,5-trihydroxybenzoyl)oxyacetate. InChIKey: RWYKOCBLMVTRSK-UHFFFAOYSA-M.
| Molecular formula | C9H7NaO7 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | sodium 2-(3,4,5-trihydroxybenzoyl)oxyacetate |
| InChIKey | RWYKOCBLMVTRSK-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)