Products 1909320-30-4
CAS 1909320-30-4 is the registry number for 1-(4-Fluorophenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazol-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine;hydrochloride (CAS 1909320-30-4) is a chemical compound with the molecular formula C12H13ClFN3 and a molecular weight of 253.70 g/mol. IUPAC name: 1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine;hydrochloride. InChIKey: OWYZHIQMXMUIHX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClFN3 |
|---|---|
| Molecular weight | 253.70 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine;hydrochloride |
| InChIKey | OWYZHIQMXMUIHX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2N)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)