CAS 1909325-53-6 appears in our catalog under these names: 2-Amino-2-(3,5-dichlorophenyl)propan-1-ol hydrochloride, 95%, 2-Amino-2-(3,5-dichlorophenyl)propan-1-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-2-(3,5-dichlorophenyl)propan-1-ol;hydrochloride (CAS 1909325-53-6) is a chemical compound with the molecular formula C9H12Cl3NO and a molecular weight of 256.6 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)propan-1-ol;hydrochloride. InChIKey: GJIBHWQBMMGPDW-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3NO |
|---|---|
| Molecular weight | 256.6 g/mol |
| IUPAC name | 2-amino-2-(3,5-dichlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | GJIBHWQBMMGPDW-UHFFFAOYSA-N |
| SMILES | CC(CO)(C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)