Products 1909325-77-4

CAS 1909325-77-4 is the registry number for tert-Butyl N-((1-bromo-3-methylbutan-2-yl)oxy)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-bromo-3-methylbutan-2-yl)oxycarbamate (CAS 1909325-77-4) is a chemical compound with the molecular formula C10H20BrNO3 and a molecular weight of 282.17 g/mol. IUPAC name: tert-butyl N-(1-bromo-3-methylbutan-2-yl)oxycarbamate. InChIKey: SINRFUBLTQQKKB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20BrNO3
Molecular weight282.17 g/mol
IUPAC nametert-butyl N-(1-bromo-3-methylbutan-2-yl)oxycarbamate
InChIKeySINRFUBLTQQKKB-UHFFFAOYSA-N
SMILESCC(C)C(CBr)ONC(=O)OC(C)(C)C

Computed by PubChem (NCBI)