CAS 1909326-28-8 appears in our catalog under these names: 3-(1-Amino-2,2-dimethylpropyl)-1,2,4-oxadiazol-5-ol, trifluoroacetic acid, 95%, 3-(1-Amino-2,2-dimethylpropyl)-1,2,4-oxadiazol-5-ol, trifluoroacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(1-amino-2,2-dimethylpropyl)-4H-1,2,4-oxadiazol-5-one;2,2,2-trifluoroacetic acid (CAS 1909326-28-8) is a chemical compound with the molecular formula C9H14F3N3O4 and a molecular weight of 285.22 g/mol. IUPAC name: 3-(1-amino-2,2-dimethylpropyl)-4H-1,2,4-oxadiazol-5-one;2,2,2-trifluoroacetic acid. InChIKey: IRLYJTUCNHZPMI-UHFFFAOYSA-N.
| Molecular formula | C9H14F3N3O4 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | 3-(1-amino-2,2-dimethylpropyl)-4H-1,2,4-oxadiazol-5-one;2,2,2-trifluoroacetic acid |
| InChIKey | IRLYJTUCNHZPMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=NOC(=O)N1)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)