Products 1909326-37-9
CAS 1909326-37-9 appears in our catalog under these names: 3-Phenylbicyclo[1.1.0]butane-1-carboxylic acid, 97%, 97%, 3-Phenylbicyclo[1.1.0]butane-1-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
3-phenylbicyclo[1.1.0]butane-1-carboxylic acid (CAS 1909326-37-9) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 3-phenylbicyclo[1.1.0]butane-1-carboxylic acid. InChIKey: HEXNLIYFOJQFKV-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3-phenylbicyclo[1.1.0]butane-1-carboxylic acid |
| InChIKey | HEXNLIYFOJQFKV-UHFFFAOYSA-N |
| SMILES | C1C2(C1(C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)