CAS 1909328-01-3 is the registry number for Sodium 5-fluoro-1,3-benzothiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 5-fluoro-1,3-benzothiazole-2-carboxylate (CAS 1909328-01-3) is a chemical compound with the molecular formula C8H3FNNaO2S and a molecular weight of 219.17 g/mol. IUPAC name: sodium 5-fluoro-1,3-benzothiazole-2-carboxylate. InChIKey: CFHCHYNRSGHEHR-UHFFFAOYSA-M.
| Molecular formula | C8H3FNNaO2S |
|---|---|
| Molecular weight | 219.17 g/mol |
| IUPAC name | sodium 5-fluoro-1,3-benzothiazole-2-carboxylate |
| InChIKey | CFHCHYNRSGHEHR-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=C1F)N=C(S2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)