CAS 1909336-60-2 appears in our catalog under these names: 1-(3-(Trifluoromethyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride, 95%, 1-(3-(Trifluoromethyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1909336-60-2) is a chemical compound with the molecular formula C5H7ClF3N3O and a molecular weight of 217.58 g/mol. IUPAC name: 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: VVSXBRKSGCTQMN-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF3N3O |
|---|---|
| Molecular weight | 217.58 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | VVSXBRKSGCTQMN-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)