CAS 1909336-80-6 is the registry number for 6-Fluoro-8-iodo-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-fluoro-8-iodo-3H-quinazolin-4-one (CAS 1909336-80-6) is a chemical compound with the molecular formula C8H4FIN2O and a molecular weight of 290.03 g/mol. IUPAC name: 6-fluoro-8-iodo-3H-quinazolin-4-one. InChIKey: XPAVOKIXWXFPAT-UHFFFAOYSA-N.
| Molecular formula | C8H4FIN2O |
|---|---|
| Molecular weight | 290.03 g/mol |
| IUPAC name | 6-fluoro-8-iodo-3H-quinazolin-4-one |
| InChIKey | XPAVOKIXWXFPAT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)NC=N2)I)F |
Computed by PubChem (NCBI)