CAS 1909336-87-3 appears in our catalog under these names: Sodium 2-(4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl)acetate, 95%, Sodium 2-(4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]acetate (CAS 1909336-87-3) is a chemical compound with the molecular formula C10H8NNaO3S and a molecular weight of 245.23 g/mol. IUPAC name: sodium 2-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]acetate. InChIKey: GWPYWHOYWCXOPS-UHFFFAOYSA-M.
| Molecular formula | C10H8NNaO3S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | sodium 2-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]acetate |
| InChIKey | GWPYWHOYWCXOPS-UHFFFAOYSA-M |
| SMILES | CC1=C(N=C(S1)CC(=O)[O-])C2=CC=CO2.[Na+] |
Computed by PubChem (NCBI)