Products 1909337-18-3

CAS 1909337-18-3 is the registry number for 4-(4-(Propan-2-yl)piperazin-1-yl)butanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(4-propan-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride (CAS 1909337-18-3) is a chemical compound with the molecular formula C11H24Cl2N2O2 and a molecular weight of 287.22 g/mol. IUPAC name: 4-(4-propan-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride. InChIKey: VCXWXEZKPGTJRP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24Cl2N2O2
Molecular weight287.22 g/mol
IUPAC name4-(4-propan-2-ylpiperazin-1-yl)butanoic acid;dihydrochloride
InChIKeyVCXWXEZKPGTJRP-UHFFFAOYSA-N
SMILESCC(C)N1CCN(CC1)CCCC(=O)O.Cl.Cl

Computed by PubChem (NCBI)