CAS 1909337-34-3 is the registry number for 3-(3-(Trifluoromethyl)phenyl)-1,2-thiazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-4-sulfonyl chloride (CAS 1909337-34-3) is a chemical compound with the molecular formula C10H5ClF3NO2S2 and a molecular weight of 327.7 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-4-sulfonyl chloride. InChIKey: SQPDZDJULXCAFM-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3NO2S2 |
|---|---|
| Molecular weight | 327.7 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-4-sulfonyl chloride |
| InChIKey | SQPDZDJULXCAFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NSC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)