Products 1909337-34-3

CAS 1909337-34-3 is the registry number for 3-(3-(Trifluoromethyl)phenyl)-1,2-thiazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-4-sulfonyl chloride (CAS 1909337-34-3) is a chemical compound with the molecular formula C10H5ClF3NO2S2 and a molecular weight of 327.7 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-4-sulfonyl chloride. InChIKey: SQPDZDJULXCAFM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5ClF3NO2S2
Molecular weight327.7 g/mol
IUPAC name3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-4-sulfonyl chloride
InChIKeySQPDZDJULXCAFM-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(F)(F)F)C2=NSC=C2S(=O)(=O)Cl

Computed by PubChem (NCBI)