Products 1909337-52-5
CAS 1909337-52-5 is the registry number for Methyl 2-(4-(chlorosulfonyl)-2-fluorophenyl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(4-chlorosulfonyl-2-fluorophenyl)acetate (CAS 1909337-52-5) is a chemical compound with the molecular formula C9H8ClFO4S and a molecular weight of 266.67 g/mol. IUPAC name: methyl 2-(4-chlorosulfonyl-2-fluorophenyl)acetate. InChIKey: RBQNJGUVZXDBMN-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO4S |
|---|---|
| Molecular weight | 266.67 g/mol |
| IUPAC name | methyl 2-(4-chlorosulfonyl-2-fluorophenyl)acetate |
| InChIKey | RBQNJGUVZXDBMN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)