CAS 1909337-86-5 is the registry number for Sodium 5-{5H,6H,7H,8H-imidazo(1,2-a)pyrazin-7-yl}thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)thiophene-2-carboxylate (CAS 1909337-86-5) is a chemical compound with the molecular formula C11H10N3NaO2S and a molecular weight of 271.27 g/mol. IUPAC name: sodium 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)thiophene-2-carboxylate. InChIKey: VTULARIXRYNCGT-UHFFFAOYSA-M.
| Molecular formula | C11H10N3NaO2S |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | sodium 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)thiophene-2-carboxylate |
| InChIKey | VTULARIXRYNCGT-UHFFFAOYSA-M |
| SMILES | C1CN2C=CN=C2CN1C3=CC=C(S3)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)