CAS 1909347-95-0 is the registry number for Lithium 2-(4-aminopyrimidin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 2-(4-aminopyrimidin-2-yl)acetate (CAS 1909347-95-0) is a chemical compound with the molecular formula C6H6LiN3O2 and a molecular weight of 159.1 g/mol. IUPAC name: lithium 2-(4-aminopyrimidin-2-yl)acetate. InChIKey: AFIPSIWUQOHISX-UHFFFAOYSA-M.
| Molecular formula | C6H6LiN3O2 |
|---|---|
| Molecular weight | 159.1 g/mol |
| IUPAC name | lithium 2-(4-aminopyrimidin-2-yl)acetate |
| InChIKey | AFIPSIWUQOHISX-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CN=C(N=C1N)CC(=O)[O-] |
Computed by PubChem (NCBI)