CAS 1909348-56-6 is the registry number for (2,4-Difluoro-5-nitrophenyl)methanamine hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,4-difluoro-5-nitrophenyl)methanamine;hydrobromide (CAS 1909348-56-6) is a chemical compound with the molecular formula C7H7BrF2N2O2 and a molecular weight of 269.04 g/mol. IUPAC name: (2,4-difluoro-5-nitrophenyl)methanamine;hydrobromide. InChIKey: CKIUFYYLQUCOGC-UHFFFAOYSA-N.
| Molecular formula | C7H7BrF2N2O2 |
|---|---|
| Molecular weight | 269.04 g/mol |
| IUPAC name | (2,4-difluoro-5-nitrophenyl)methanamine;hydrobromide |
| InChIKey | CKIUFYYLQUCOGC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)CN.Br |
Computed by PubChem (NCBI)