CAS 1909348-66-8 is the registry number for Methyl 2-fluoro-5-hydrazinylbenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-fluoro-5-hydrazinylbenzoate;hydrochloride (CAS 1909348-66-8) is a chemical compound with the molecular formula C8H10ClFN2O2 and a molecular weight of 220.63 g/mol. IUPAC name: methyl 2-fluoro-5-hydrazinylbenzoate;hydrochloride. InChIKey: WCLMIRIEDZTKRP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O2 |
|---|---|
| Molecular weight | 220.63 g/mol |
| IUPAC name | methyl 2-fluoro-5-hydrazinylbenzoate;hydrochloride |
| InChIKey | WCLMIRIEDZTKRP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)NN)F.Cl |
Computed by PubChem (NCBI)