CAS 1909358-87-7 appears in our catalog under these names: 3-(4-Bromobut-1-en-1-yl)-5-methoxypyridine hydrobromide, 95%, 3-(4-Bromobut-1-en-1-yl)-5-methoxypyridine hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[(E)-4-bromobut-1-enyl]-5-methoxypyridine;hydrobromide (CAS 1909358-87-7) is a chemical compound with the molecular formula C10H13Br2NO and a molecular weight of 323.02 g/mol. IUPAC name: 3-[(E)-4-bromobut-1-enyl]-5-methoxypyridine;hydrobromide. InChIKey: YEJPVFUSJYDQBT-VEELZWTKSA-N.
| Molecular formula | C10H13Br2NO |
|---|---|
| Molecular weight | 323.02 g/mol |
| IUPAC name | 3-[(E)-4-bromobut-1-enyl]-5-methoxypyridine;hydrobromide |
| InChIKey | YEJPVFUSJYDQBT-VEELZWTKSA-N |
| SMILES | COC1=CN=CC(=C1)/C=C/CCBr.Br |
Computed by PubChem (NCBI)