CAS 190973-06-9 is the registry number for 8-C-Phenylchrysin. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dihydroxy-2,8-diphenylchromen-4-one (CAS 190973-06-9) is a chemical compound with the molecular formula C21H14O4 and a molecular weight of 330.3 g/mol. IUPAC name: 5,7-dihydroxy-2,8-diphenylchromen-4-one. InChIKey: RGLIOSJKHPSHPA-UHFFFAOYSA-N.
| Molecular formula | C21H14O4 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 5,7-dihydroxy-2,8-diphenylchromen-4-one |
| InChIKey | RGLIOSJKHPSHPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)