CAS 191106-25-9 appears in our catalog under these names: 3-(Bromomethyl)-1-chloronaphthalene, 95%, 95%, 3-(BROMOMETHYL)-1-CHLORONAPHTHALENE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(bromomethyl)-1-chloronaphthalene (CAS 191106-25-9) is a chemical compound with the molecular formula C11H8BrCl and a molecular weight of 255.54 g/mol. IUPAC name: 3-(bromomethyl)-1-chloronaphthalene. InChIKey: IATLQBVTUYTBDI-UHFFFAOYSA-N.
| Molecular formula | C11H8BrCl |
|---|---|
| Molecular weight | 255.54 g/mol |
| IUPAC name | 3-(bromomethyl)-1-chloronaphthalene |
| InChIKey | IATLQBVTUYTBDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2Cl)CBr |
Computed by PubChem (NCBI)