CAS 191154-43-5 is the registry number for 2-((3,4-Dichlorophenyl)sulfanyl)-5-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3,4-dichlorophenyl)sulfanyl-5-fluorobenzoic acid (CAS 191154-43-5) is a chemical compound with the molecular formula C13H7Cl2FO2S and a molecular weight of 317.2 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)sulfanyl-5-fluorobenzoic acid. InChIKey: FARCVLAVXHVIDA-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2FO2S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)sulfanyl-5-fluorobenzoic acid |
| InChIKey | FARCVLAVXHVIDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)SC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)