CAS 1911578-88-5 is the registry number for Sofosbuvir Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (CAS 1911578-88-5) is a chemical compound with the molecular formula C16H13F5NO5P and a molecular weight of 425.24 g/mol. IUPAC name: methyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate. InChIKey: FIQONWLCORPCLX-DHYAIILCSA-N.
| Molecular formula | C16H13F5NO5P |
|---|---|
| Molecular weight | 425.24 g/mol |
| IUPAC name | methyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| InChIKey | FIQONWLCORPCLX-DHYAIILCSA-N |
| SMILES | C[C@@H](C(=O)OC)NP(=O)(OC1=CC=CC=C1)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)