CAS 1911629-44-1 is the registry number for Aurora kinase-IN-8. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 50 mg, 100 mg.
7-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-[(E)-2-phenylethenyl]quinazolin-4-amine (CAS 1911629-44-1) is a chemical compound with the molecular formula C25H27N7 and a molecular weight of 425.5 g/mol. IUPAC name: 7-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-[(E)-2-phenylethenyl]quinazolin-4-amine. InChIKey: DKCSQCAVMRLWQW-DHZHZOJOSA-N.
| Molecular formula | C25H27N7 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 7-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)-2-[(E)-2-phenylethenyl]quinazolin-4-amine |
| InChIKey | DKCSQCAVMRLWQW-DHZHZOJOSA-N |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC3=C2C=CC(=C3)N4CCN(CC4)C)/C=C/C5=CC=CC=C5 |
Computed by PubChem (NCBI)