CAS 191211-62-8 is the registry number for Pentan-3-yl Trifluoromethanesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Pentan-3-yl trifluoromethanesulfonate (CAS 191211-62-8) is a chemical compound with the molecular formula C6H11F3O3S and a molecular weight of 220.21 g/mol. IUPAC name: pentan-3-yl trifluoromethanesulfonate. InChIKey: DOHFYHRENNMQST-UHFFFAOYSA-N.
| Molecular formula | C6H11F3O3S |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | pentan-3-yl trifluoromethanesulfonate |
| InChIKey | DOHFYHRENNMQST-UHFFFAOYSA-N |
| SMILES | CCC(CC)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)